C21H19NO2 — CID 54691171
6-benzyl-7-hydroxy-8-phenyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 54691171) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-benzyl-7-hydroxy-8-phenyl-2,3-dihydro-1H-indolizin-5-one.
| Compound Name | 6-benzyl-7-hydroxy-8-phenyl-2,3-dihydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 54691171 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-benzyl-7-hydroxy-8-phenyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | O=c1c(Cc2ccccc2)c(O)c(-c2ccccc2)c2n1CCC2 |
| InChI | InChI=1S/C21H19NO2/c23-20-17(14-15-8-3-1-4-9-15)21(24)22-13-7-12-18(22)19(20)16-10-5-2-6-11-16/h1-6,8-11,23H,7,12-14H2 |
| InChIKey | IIQJCDJTZBGECC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |