C18H17Cl2N3O3 — CID 54692335
11-[(3,4-dichlorophenyl)methyl]-8-hydroxy-5-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione (PubChem CID 54692335) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is 11-[(3,4-dichlorophenyl)methyl]-8-hydroxy-5-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione.
| Compound Name | 11-[(3,4-dichlorophenyl)methyl]-8-hydroxy-5-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione |
|---|---|
| PubChem CID | 54692335 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 11-[(3,4-dichlorophenyl)methyl]-8-hydroxy-5-methyl-1,5,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene-6,10-dione |
| SMILES | CN1CCc2c(c(O)c3n2CCN(Cc2ccc(Cl)c(Cl)c2)C3=O)C1=O |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-21-5-4-13-14(17(21)25)16(24)15-18(26)22(6-7-23(13)15)9-10-2-3-11(19)12(20)8-10/h2-3,8,24H,4-7,9H2,1H3 |
| InChIKey | SQSGGWGZQQYCON-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |