C13H10ClNO4 — CID 54692480
methyl 6-(4-chlorophenyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 54692480) has the molecular formula C13H10ClNO4 and a molecular weight of 279.68 g/mol. Its IUPAC name is methyl 6-(4-chlorophenyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-(4-chlorophenyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54692480 |
| Molecular Formula | C13H10ClNO4 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | methyl 6-(4-chlorophenyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(O)cc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C13H10ClNO4/c1-19-13(18)11-10(16)6-9(15-12(11)17)7-2-4-8(14)5-3-7/h2-6H,1H3,(H2,15,16,17) |
| InChIKey | LNUBAZPCGMMESE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |