C28H34N3NaO11S — CID 54692942
sodium 2-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]-4-methylsulfinylbutanoate (PubChem CID 54692942) has the molecular formula C28H34N3NaO11S and a molecular weight of 643.65 g/mol. Its IUPAC name is sodium 2-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]-4-methylsulfinylbutanoate.
| Compound Name | sodium 2-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]-4-methylsulfinylbutanoate |
|---|---|
| PubChem CID | 54692942 |
| Molecular Formula | C28H34N3NaO11S |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | sodium 2-[[[4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]-4-methylsulfinylbutanoate |
| SMILES | CN(C)C1C(=O)C(C(=O)NCNC(CCS(C)=O)C(=O)[O-])=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3CC12.[Na+] |
| InChI | InChI=1S/C28H35N3O11S.Na/c1-27(40)12-6-5-7-16(32)17(12)21(33)18-13(27)10-14-20(31(2)3)22(34)19(24(36)28(14,41)23(18)35)25(37)30-11-29-15(26(38)39)8-9-43(4)42;/h5-7,13-15,20,29,32-33,36,40-41H,8-11H2,1-4H3,(H,30,37)(H,38,39);/q;+1/p-1 |
| InChIKey | CEDGUZQFGUWKDR-UHFFFAOYSA-M |
| XLogP | -5.30 |
| TPSA | 236.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|