C41H41ClN2P2Ru — CID 54695427
chlororuthenium(1+);4-diphenylphosphanylbutyl(diphenyl)phosphane;[6-(4-methylbenzene-6-id-1-yl)-2-pyridinyl]methanamine (PubChem CID 54695427) has the molecular formula C41H41ClN2P2Ru and a molecular weight of 760.26 g/mol. Its IUPAC name is chlororuthenium(1+);4-diphenylphosphanylbutyl(diphenyl)phosphane;[6-(4-methylbenzene-6-id-1-yl)-2-pyridinyl]methanamine.
| Compound Name | chlororuthenium(1+);4-diphenylphosphanylbutyl(diphenyl)phosphane;[6-(4-methylbenzene-6-id-1-yl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 54695427 |
| Molecular Formula | C41H41ClN2P2Ru |
| Molecular Weight | 760.26 g/mol |
| Exact Mass | 760.15 |
| IUPAC Name | chlororuthenium(1+);4-diphenylphosphanylbutyl(diphenyl)phosphane;[6-(4-methylbenzene-6-id-1-yl)-2-pyridinyl]methanamine |
| SMILES | Cc1c[c-]c(-c2cccc(CN)n2)cc1.Cl[Ru+].c1ccc(P(CCCCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28P2.C13H13N2.ClH.Ru/c1-5-15-25(16-6-1)29(26-17-7-2-8-18-26)23-13-14-24-30(27-19-9-3-10-20-27)28-21-11-4-12-22-28;1-10-5-7-11(8-6-10)13-4-2-3-12(9-14)15-13;;/h1-12,15-22H,13-14,23-24H2;2-7H,9,14H2,1H3;1H;/q;-1;;+2/p-1 |
| InChIKey | ADFSXLPAFDLLDJ-UHFFFAOYSA-M |
| XLogP | 9.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.26 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|