C24H26N4O3 — CID 5469578
N-[1-methyl-5-[(E)-3-[(1R,12S)-3-methyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]pyrrol-3-yl]butanamide (PubChem CID 5469578) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[1-methyl-5-[(E)-3-[(1R,12S)-3-methyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]pyrrol-3-yl]butanamide.
| Compound Name | N-[1-methyl-5-[(E)-3-[(1R,12S)-3-methyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]pyrrol-3-yl]butanamide |
|---|---|
| PubChem CID | 5469578 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[1-methyl-5-[(E)-3-[(1R,12S)-3-methyl-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-10-yl]-3-oxoprop-1-enyl]pyrrol-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1cc(/C=C/C(=O)N2C[C@H]3C[C@@]34C2=CC(=O)c2[nH]cc(C)c24)n(C)c1 |
| InChI | InChI=1S/C24H26N4O3/c1-4-5-20(30)26-16-8-17(27(3)13-16)6-7-21(31)28-12-15-10-24(15)19(28)9-18(29)23-22(24)14(2)11-25-23/h6-9,11,13,15,25H,4-5,10,12H2,1-3H3,(H,26,30)/b7-6+/t15-,24+/m1/s1 |
| InChIKey | DJFXWTPYURSOOJ-ZVOCJMRISA-N |
| XLogP | 3.29 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|