C28H20N2O5 — CID 54697123
2-[[4-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-4-oxobut-2-en-2-yl]amino]anthracene-9,10-dione (PubChem CID 54697123) has the molecular formula C28H20N2O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-[[4-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-4-oxobut-2-en-2-yl]amino]anthracene-9,10-dione.
| Compound Name | 2-[[4-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-4-oxobut-2-en-2-yl]amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 54697123 |
| Molecular Formula | C28H20N2O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[[4-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-4-oxobut-2-en-2-yl]amino]anthracene-9,10-dione |
| SMILES | CC(=CC(=O)c1c(O)c2ccccc2n(C)c1=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H20N2O5/c1-15(13-23(31)24-27(34)20-9-5-6-10-22(20)30(2)28(24)35)29-16-11-12-19-21(14-16)26(33)18-8-4-3-7-17(18)25(19)32/h3-14,29,34H,1-2H3 |
| InChIKey | UPVQYTGDLZNKNF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|