About (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate
(Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate (PubChem CID 54705150) has the molecular formula C14H9O4-
and a molecular weight of 241.22 g/mol. Its IUPAC name is (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate.
Molecular Properties
| Compound Name | (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate |
| PubChem CID | 54705150 |
| Molecular Formula | C14H9O4- |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate |
| SMILES | O=C(O)C(=O)/C=C(\[O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C14H10O4/c15-12(8-13(16)14(17)18)11-7-3-5-9-4-1-2-6-10(9)11/h1-8,15H,(H,17,18)/p-1/b12-8- |
| InChIKey | YPYXGONIAKMTFH-WQLSENKSSA-M |
| XLogP | 1.19 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate?
The IUPAC name of (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate (CID 54705150) is (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate.
What is the SMILES notation for (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate?
The canonical SMILES for (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate is O=C(O)C(=O)/C=C(\[O-])c1cccc2ccccc12.
What is the InChIKey of (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate?
The InChIKey is YPYXGONIAKMTFH-WQLSENKSSA-M. The full InChI is InChI=1S/C14H10O4/c15-12(8-13(16)14(17)18)11-7-3-5-9-4-1-2-6-10(9)11/h1-8,15H,(H,17,18)/p-1/b12-8-.
What are the key properties of (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate?
(Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate has a molecular weight of 241.22 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxy-1-naphthalen-1-yl-3,4-dioxobut-1-en-1-olate is sourced from PubChem (CID 54705150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).