C23H29N2O6S+ — CID 54706109
(1-ethyl-4-hydroxy-7-methyl-2-oxo-1,8-naphthyridin-3-yl)-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium (PubChem CID 54706109) has the molecular formula C23H29N2O6S+ and a molecular weight of 461.56 g/mol. Its IUPAC name is (1-ethyl-4-hydroxy-7-methyl-2-oxo-1,8-naphthyridin-3-yl)-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium.
| Compound Name | (1-ethyl-4-hydroxy-7-methyl-2-oxo-1,8-naphthyridin-3-yl)-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium |
|---|---|
| PubChem CID | 54706109 |
| Molecular Formula | C23H29N2O6S+ |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (1-ethyl-4-hydroxy-7-methyl-2-oxo-1,8-naphthyridin-3-yl)-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium |
| SMILES | CCn1c(=O)c([S+](C)CCOc2cc(OC)c(OC)c(OC)c2)c(O)c2ccc(C)nc21 |
| InChI | InChI=1S/C23H28N2O6S/c1-7-25-22-16(9-8-14(2)24-22)19(26)21(23(25)27)32(6)11-10-31-15-12-17(28-3)20(30-5)18(13-15)29-4/h8-9,12-13H,7,10-11H2,1-6H3/p+1 |
| InChIKey | YAMXYFZWVGTQLE-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|