C24H30N2O6S — CID 21036607
7-methyl-3-[methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfonio]-2-oxo-1-propyl-1,8-naphthyridin-4-olate (PubChem CID 21036607) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is 7-methyl-3-[methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfonio]-2-oxo-1-propyl-1,8-naphthyridin-4-olate.
| Compound Name | 7-methyl-3-[methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfonio]-2-oxo-1-propyl-1,8-naphthyridin-4-olate |
|---|---|
| PubChem CID | 21036607 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 7-methyl-3-[methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfonio]-2-oxo-1-propyl-1,8-naphthyridin-4-olate |
| SMILES | CCCn1c(=O)c([S+](C)CCOc2cc(OC)c(OC)c(OC)c2)c([O-])c2ccc(C)nc21 |
| InChI | InChI=1S/C24H30N2O6S/c1-7-10-26-23-17(9-8-15(2)25-23)20(27)22(24(26)28)33(6)12-11-32-16-13-18(29-3)21(31-5)19(14-16)30-4/h8-9,13-14H,7,10-12H2,1-6H3 |
| InChIKey | BZOMOLVUBCJMMZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|