C24H31N2O6S+ — CID 54706110
[4-hydroxy-1-(2-methylpropyl)-2-oxo-1,8-naphthyridin-3-yl]-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium (PubChem CID 54706110) has the molecular formula C24H31N2O6S+ and a molecular weight of 475.59 g/mol. Its IUPAC name is [4-hydroxy-1-(2-methylpropyl)-2-oxo-1,8-naphthyridin-3-yl]-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium.
| Compound Name | [4-hydroxy-1-(2-methylpropyl)-2-oxo-1,8-naphthyridin-3-yl]-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium |
|---|---|
| PubChem CID | 54706110 |
| Molecular Formula | C24H31N2O6S+ |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [4-hydroxy-1-(2-methylpropyl)-2-oxo-1,8-naphthyridin-3-yl]-methyl-[2-(3,4,5-trimethoxyphenoxy)ethyl]sulfanium |
| SMILES | COc1cc(OCC[S+](C)c2c(O)c3cccnc3n(CC(C)C)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N2O6S/c1-15(2)14-26-23-17(8-7-9-25-23)20(27)22(24(26)28)33(6)11-10-32-16-12-18(29-3)21(31-5)19(13-16)30-4/h7-9,12-13,15H,10-11,14H2,1-6H3/p+1 |
| InChIKey | RCAJRTSNHCXNHC-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|