C30H49NO7 — CID 54706343
5-(1,2-dihydroxy-4,4-dimethoxycyclohexyl)-3-[6-[(E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methylpyridin-2-one (PubChem CID 54706343) has the molecular formula C30H49NO7 and a molecular weight of 535.72 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-4,4-dimethoxycyclohexyl)-3-[6-[(E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methylpyridin-2-one.
| Compound Name | 5-(1,2-dihydroxy-4,4-dimethoxycyclohexyl)-3-[6-[(E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 54706343 |
| Molecular Formula | C30H49NO7 |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.35 |
| IUPAC Name | 5-(1,2-dihydroxy-4,4-dimethoxycyclohexyl)-3-[6-[(E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methylpyridin-2-one |
| SMILES | CCC(C)CC(C)/C=C(\C)C1OC(c2c(O)c(C3(O)CCC(OC)(OC)CC3O)cn(C)c2=O)CCC1C |
| InChI | InChI=1S/C30H49NO7/c1-9-18(2)14-19(3)15-21(5)27-20(4)10-11-23(38-27)25-26(33)22(17-31(6)28(25)34)30(35)13-12-29(36-7,37-8)16-24(30)32/h15,17-20,23-24,27,32-33,35H,9-14,16H2,1-8H3/b21-15+ |
| InChIKey | OKLOELQSMKXXGE-RCCKNPSSSA-N |
| XLogP | 4.69 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|