C19H32O3 — CID 163155721
2-ethyl-2-hydroxy-5-(4,6,8-trimethyldec-2-en-2-yl)furan-3-one (PubChem CID 163155721) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-ethyl-2-hydroxy-5-(4,6,8-trimethyldec-2-en-2-yl)furan-3-one.
| Compound Name | 2-ethyl-2-hydroxy-5-(4,6,8-trimethyldec-2-en-2-yl)furan-3-one |
|---|---|
| PubChem CID | 163155721 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2-ethyl-2-hydroxy-5-(4,6,8-trimethyldec-2-en-2-yl)furan-3-one |
| SMILES | CCC(C)CC(C)CC(C)C=C(C)C1=CC(=O)C(O)(CC)O1 |
| InChI | InChI=1S/C19H32O3/c1-7-13(3)9-14(4)10-15(5)11-16(6)17-12-18(20)19(21,8-2)22-17/h11-15,21H,7-10H2,1-6H3 |
| InChIKey | PAKCBQUQPXFYFI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |