C11H8NO5S- — CID 54706650
2-carboxy-4-sulfamoylnaphthalen-1-olate (PubChem CID 54706650) has the molecular formula C11H8NO5S- and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-carboxy-4-sulfamoylnaphthalen-1-olate.
| Compound Name | 2-carboxy-4-sulfamoylnaphthalen-1-olate |
|---|---|
| PubChem CID | 54706650 |
| Molecular Formula | C11H8NO5S- |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-carboxy-4-sulfamoylnaphthalen-1-olate |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c([O-])c2ccccc12 |
| InChI | InChI=1S/C11H9NO5S/c12-18(16,17)9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,13H,(H,14,15)(H2,12,16,17)/p-1 |
| InChIKey | OTDVKOVLSPJORY-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |