C23H27NO3 — CID 54707119
phenyl (2Z,4Z)-5-(tert-butylamino)-3-hydroxy-2,4-dimethyl-5-phenylpenta-2,4-dienoate (PubChem CID 54707119) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is phenyl (2Z,4Z)-5-(tert-butylamino)-3-hydroxy-2,4-dimethyl-5-phenylpenta-2,4-dienoate.
| Compound Name | phenyl (2Z,4Z)-5-(tert-butylamino)-3-hydroxy-2,4-dimethyl-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 54707119 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | phenyl (2Z,4Z)-5-(tert-butylamino)-3-hydroxy-2,4-dimethyl-5-phenylpenta-2,4-dienoate |
| SMILES | C/C(C(=O)Oc1ccccc1)=C(O)\C(C)=C(/NC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H27NO3/c1-16(20(24-23(3,4)5)18-12-8-6-9-13-18)21(25)17(2)22(26)27-19-14-10-7-11-15-19/h6-15,24-25H,1-5H3/b20-16-,21-17- |
| InChIKey | ABVZYVHZCXETKU-ISPAOBMBSA-N |
| XLogP | 5.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|