C28H22N4O4S3 — CID 5470725
3-[4-(1,3-benzothiazol-2-yl)-3-oxo-8-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-thia-4,6,7-triazaspiro[4.4]non-7-en-6-yl]benzenesulfonic acid (PubChem CID 5470725) has the molecular formula C28H22N4O4S3 and a molecular weight of 574.71 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)-3-oxo-8-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-thia-4,6,7-triazaspiro[4.4]non-7-en-6-yl]benzenesulfonic acid.
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)-3-oxo-8-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-thia-4,6,7-triazaspiro[4.4]non-7-en-6-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 5470725 |
| Molecular Formula | C28H22N4O4S3 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)-3-oxo-8-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1-thia-4,6,7-triazaspiro[4.4]non-7-en-6-yl]benzenesulfonic acid |
| SMILES | O=C1CSC2(CC(/C=C/C=C/c3ccccc3)=NN2c2cccc(S(=O)(=O)O)c2)N1c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H22N4O4S3/c33-26-19-37-28(31(26)27-29-24-15-6-7-16-25(24)38-27)18-21(12-5-4-11-20-9-2-1-3-10-20)30-32(28)22-13-8-14-23(17-22)39(34,35)36/h1-17H,18-19H2,(H,34,35,36)/b11-4+,12-5+ |
| InChIKey | ASXJIUKCYSKBQT-JLYPQOKGSA-N |
| XLogP | 5.81 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|