C20H22N2O3 — CID 54708143
4-acetyl-3-hydroxy-2-[[4-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-1,2-dihydropyrrol-5-one (PubChem CID 54708143) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-acetyl-3-hydroxy-2-[[4-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-1,2-dihydropyrrol-5-one.
| Compound Name | 4-acetyl-3-hydroxy-2-[[4-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 54708143 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-acetyl-3-hydroxy-2-[[4-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-1,2-dihydropyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(Cc2c[nH]c3cccc(CC=C(C)C)c23)NC1=O |
| InChI | InChI=1S/C20H22N2O3/c1-11(2)7-8-13-5-4-6-15-18(13)14(10-21-15)9-16-19(24)17(12(3)23)20(25)22-16/h4-7,10,16,21,24H,8-9H2,1-3H3,(H,22,25) |
| InChIKey | MVUXMIXDFMUPLL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|