C15H8O5S — CID 54709877
1-(4-hydroxy-2-oxochromen-3-yl)-2-thiophen-2-ylethane-1,2-dione (PubChem CID 54709877) has the molecular formula C15H8O5S and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-(4-hydroxy-2-oxochromen-3-yl)-2-thiophen-2-ylethane-1,2-dione.
| Compound Name | 1-(4-hydroxy-2-oxochromen-3-yl)-2-thiophen-2-ylethane-1,2-dione |
|---|---|
| PubChem CID | 54709877 |
| Molecular Formula | C15H8O5S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 1-(4-hydroxy-2-oxochromen-3-yl)-2-thiophen-2-ylethane-1,2-dione |
| SMILES | O=C(C(=O)c1c(O)c2ccccc2oc1=O)c1cccs1 |
| InChI | InChI=1S/C15H8O5S/c16-12-8-4-1-2-5-9(8)20-15(19)11(12)14(18)13(17)10-6-3-7-21-10/h1-7,16H |
| InChIKey | JCVWZFUUKUTJMJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|