C12H19BrN2Pt — CID 54713754
bromoplatinum(1+);1-[3-[(dimethylamino)methyl]benzene-2-id-1-yl]-N,N-dimethylmethanamine (PubChem CID 54713754) has the molecular formula C12H19BrN2Pt and a molecular weight of 466.28 g/mol. Its IUPAC name is bromoplatinum(1+);1-[3-[(dimethylamino)methyl]benzene-2-id-1-yl]-N,N-dimethylmethanamine.
| Compound Name | bromoplatinum(1+);1-[3-[(dimethylamino)methyl]benzene-2-id-1-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 54713754 |
| Molecular Formula | C12H19BrN2Pt |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | bromoplatinum(1+);1-[3-[(dimethylamino)methyl]benzene-2-id-1-yl]-N,N-dimethylmethanamine |
| SMILES | Br[Pt+].CN(C)Cc1[c-]c(CN(C)C)ccc1 |
| InChI | InChI=1S/C12H19N2.BrH.Pt/c1-13(2)9-11-6-5-7-12(8-11)10-14(3)4;;/h5-7H,9-10H2,1-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | JBFQOUGAHDOVBM-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|