C13H14ClNPd — CID 54682191
chloropalladium(1+);N,N-dimethyl-1-(1H-naphthalen-1-id-2-yl)methanamine (PubChem CID 54682191) has the molecular formula C13H14ClNPd and a molecular weight of 326.13 g/mol. Its IUPAC name is chloropalladium(1+);N,N-dimethyl-1-(1H-naphthalen-1-id-2-yl)methanamine.
| Compound Name | chloropalladium(1+);N,N-dimethyl-1-(1H-naphthalen-1-id-2-yl)methanamine |
|---|---|
| PubChem CID | 54682191 |
| Molecular Formula | C13H14ClNPd |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | chloropalladium(1+);N,N-dimethyl-1-(1H-naphthalen-1-id-2-yl)methanamine |
| SMILES | CN(C)Cc1[c-]c2ccccc2cc1.Cl[Pd+] |
| InChI | InChI=1S/C13H14N.ClH.Pd/c1-14(2)10-11-7-8-12-5-3-4-6-13(12)9-11;;/h3-8H,10H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | KWKALJFSCCEIEN-UHFFFAOYSA-M |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|