C13H14LiN — CID 177470513
lithium N,N-dimethyl-1-(3H-naphthalen-3-id-2-yl)methanamine (PubChem CID 177470513) has the molecular formula C13H14LiN and a molecular weight of 191.20 g/mol. Its IUPAC name is lithium N,N-dimethyl-1-(3H-naphthalen-3-id-2-yl)methanamine.
| Compound Name | lithium N,N-dimethyl-1-(3H-naphthalen-3-id-2-yl)methanamine |
|---|---|
| PubChem CID | 177470513 |
| Molecular Formula | C13H14LiN |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | lithium N,N-dimethyl-1-(3H-naphthalen-3-id-2-yl)methanamine |
| SMILES | CN(C)Cc1[c-]cc2ccccc2c1.[Li+] |
| InChI | InChI=1S/C13H14N.Li/c1-14(2)10-11-7-8-12-5-3-4-6-13(12)9-11;/h3-6,8-9H,10H2,1-2H3;/q-1;+1 |
| InChIKey | OMPIUYBIJZVTBQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|