About ethane;3-methyl-2H-naphthalen-2-ide;rhenium
ethane;3-methyl-2H-naphthalen-2-ide;rhenium (PubChem CID 169166845) has the molecular formula C13H15Re-
and a molecular weight of 357.47 g/mol. Its IUPAC name is ethane;3-methyl-2H-naphthalen-2-ide;rhenium.
Molecular Properties
| Compound Name | ethane;3-methyl-2H-naphthalen-2-ide;rhenium |
| PubChem CID | 169166845 |
| Molecular Formula | C13H15Re- |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | ethane;3-methyl-2H-naphthalen-2-ide;rhenium |
| SMILES | CC.Cc1[c-]cc2ccccc2c1.[Re] |
| InChI | InChI=1S/C11H9.C2H6.Re/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2;/h2-5,7-8H,1H3;1-2H3;/q-1;; |
| InChIKey | MAZRJAIEHOZYTM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-2H-naphthalen-2-ide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2H-naphthalen-2-ide;rhenium?
The IUPAC name of ethane;3-methyl-2H-naphthalen-2-ide;rhenium (CID 169166845) is ethane;3-methyl-2H-naphthalen-2-ide;rhenium.
What is the SMILES notation for ethane;3-methyl-2H-naphthalen-2-ide;rhenium?
The canonical SMILES for ethane;3-methyl-2H-naphthalen-2-ide;rhenium is CC.Cc1[c-]cc2ccccc2c1.[Re].
What is the InChIKey of ethane;3-methyl-2H-naphthalen-2-ide;rhenium?
The InChIKey is MAZRJAIEHOZYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9.C2H6.Re/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2;/h2-5,7-8H,1H3;1-2H3;/q-1;;.
What are the key properties of ethane;3-methyl-2H-naphthalen-2-ide;rhenium?
ethane;3-methyl-2H-naphthalen-2-ide;rhenium has a molecular weight of 357.47 g/mol, XLogP of 3.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2H-naphthalen-2-ide;rhenium is sourced from PubChem (CID 169166845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).