C9H16N4O3 — CID 54713807
1-nitro-2-(oxolan-2-ylmethyl)-3-prop-2-enylguanidine (PubChem CID 54713807) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-nitro-2-(oxolan-2-ylmethyl)-3-prop-2-enylguanidine.
| Compound Name | 1-nitro-2-(oxolan-2-ylmethyl)-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 54713807 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-nitro-2-(oxolan-2-ylmethyl)-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\CC1CCCO1)N[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N4O3/c1-2-5-10-9(12-13(14)15)11-7-8-4-3-6-16-8/h2,8H,1,3-7H2,(H2,10,11,12) |
| InChIKey | MADSXFYCYHWGEC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|