C12H14N4O3S2 — CID 54717099
ethyl 2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)sulfanyl-3-hydroxybut-2-enoate (PubChem CID 54717099) has the molecular formula C12H14N4O3S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is ethyl 2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)sulfanyl-3-hydroxybut-2-enoate.
| Compound Name | ethyl 2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)sulfanyl-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 54717099 |
| Molecular Formula | C12H14N4O3S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | ethyl 2-(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)sulfanyl-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(Sc1nc(N)nc(SC)c1C#N)=C(C)O |
| InChI | InChI=1S/C12H14N4O3S2/c1-4-19-11(18)8(6(2)17)21-10-7(5-13)9(20-3)15-12(14)16-10/h17H,4H2,1-3H3,(H2,14,15,16) |
| InChIKey | JEULNSRXHDBRQV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|