C22H19BrN3O4S+ — CID 54718076
(E)-1-[3-(4-bromoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium (PubChem CID 54718076) has the molecular formula C22H19BrN3O4S+ and a molecular weight of 501.38 g/mol. Its IUPAC name is (E)-1-[3-(4-bromoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium.
| Compound Name | (E)-1-[3-(4-bromoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 54718076 |
| Molecular Formula | C22H19BrN3O4S+ |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | (E)-1-[3-(4-bromoanilino)-5-(4-methoxyphenyl)thiophen-2-yl]-3-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
| SMILES | CCOC(=O)/C([N+]#N)=C(\O)c1sc(-c2ccc(OC)cc2)cc1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrN3O4S/c1-3-30-22(28)19(26-24)20(27)21-17(25-15-8-6-14(23)7-9-15)12-18(31-21)13-4-10-16(29-2)11-5-13/h4-12H,3H2,1-2H3,(H-,25,27,28)/p+1 |
| InChIKey | BZVUWCGJSNPETK-UHFFFAOYSA-O |
| XLogP | 6.57 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|