C22H34O7 — CID 54718153
methyl (E,2R,6R,9Z)-9-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methyl-9-[(6R)-6-methyl-2,4-di(18O)oxo(2,4,6-13C3,118O)oxan-3-ylidene]non-3-enoate (PubChem CID 54718153) has the molecular formula C22H34O7 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl (E,2R,6R,9Z)-9-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methyl-9-[(6R)-6-methyl-2,4-di(18O)oxo(2,4,6-13C3,118O)oxan-3-ylidene]non-3-enoate.
| Compound Name | methyl (E,2R,6R,9Z)-9-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methyl-9-[(6R)-6-methyl-2,4-di(18O)oxo(2,4,6-13C3,118O)oxan-3-ylidene]non-3-enoate |
|---|---|
| PubChem CID | 54718153 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | methyl (E,2R,6R,9Z)-9-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methyl-9-[(6R)-6-methyl-2,4-di(18O)oxo(2,4,6-13C3,118O)oxan-3-ylidene]non-3-enoate |
| SMILES | CC[C@H](C)[C@@H](O)[C@@H](/C=C/C[C@H](C)CC/C(O)=C1\[13C](=[18O])C[13C@@H](C)[18O][13C]1=[18O])C(=O)OC |
| InChI | InChI=1S/C22H34O7/c1-6-14(3)20(25)16(21(26)28-5)9-7-8-13(2)10-11-17(23)19-18(24)12-15(4)29-22(19)27/h7,9,13-16,20,23,25H,6,8,10-12H2,1-5H3/b9-7+,19-17-/t13-,14-,15+,16+,20+/m0/s1/i15+1,18+1,22+1,24+2,27+2,29+2 |
| InChIKey | WGWNKNWAUAKZKS-ZFBOZUCNSA-N |
| XLogP | 3.26 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|