C23H39NO5 — CID 54719671
2-carboxy-4-dodecanoylphenolate;(1-hydroxy-2-methylpropan-2-yl)azanium (PubChem CID 54719671) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-carboxy-4-dodecanoylphenolate;(1-hydroxy-2-methylpropan-2-yl)azanium.
| Compound Name | 2-carboxy-4-dodecanoylphenolate;(1-hydroxy-2-methylpropan-2-yl)azanium |
|---|---|
| PubChem CID | 54719671 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 2-carboxy-4-dodecanoylphenolate;(1-hydroxy-2-methylpropan-2-yl)azanium |
| SMILES | CC(C)([NH3+])CO.CCCCCCCCCCCC(=O)c1ccc([O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C19H28O4.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-17(20)15-12-13-18(21)16(14-15)19(22)23;1-4(2,5)3-6/h12-14,21H,2-11H2,1H3,(H,22,23);6H,3,5H2,1-2H3 |
| InChIKey | QCQVUQVJHUMUPP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|