C5H8N2Y+ — CID 54719925
carbanide;5-methyl-1,4-dihydroimidazol-4-ide;yttrium(3+) (PubChem CID 54719925) has the molecular formula C5H8N2Y+ and a molecular weight of 185.04 g/mol. Its IUPAC name is carbanide;5-methyl-1,4-dihydroimidazol-4-ide;yttrium(3+).
| Compound Name | carbanide;5-methyl-1,4-dihydroimidazol-4-ide;yttrium(3+) |
|---|---|
| PubChem CID | 54719925 |
| Molecular Formula | C5H8N2Y+ |
| Molecular Weight | 185.04 g/mol |
| Exact Mass | 184.97 |
| IUPAC Name | carbanide;5-methyl-1,4-dihydroimidazol-4-ide;yttrium(3+) |
| SMILES | Cc1[c-]nc[nH]1.[CH3-].[Y+3] |
| InChI | InChI=1S/C4H5N2.CH3.Y/c1-4-2-5-3-6-4;;/h3H,1H3,(H,5,6);1H3;/q2*-1;+3 |
| InChIKey | UDXUQYGLNSGNIT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.04 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|