C21H34O12 — CID 54720435
[(1S)-1-hydroxy-1-[3-hydroxy-5-oxo-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-2-yl]propan-2-yl] 2-propylpentanoate (PubChem CID 54720435) has the molecular formula C21H34O12 and a molecular weight of 478.49 g/mol. Its IUPAC name is [(1S)-1-hydroxy-1-[3-hydroxy-5-oxo-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-2-yl]propan-2-yl] 2-propylpentanoate.
| Compound Name | [(1S)-1-hydroxy-1-[3-hydroxy-5-oxo-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-2-yl]propan-2-yl] 2-propylpentanoate |
|---|---|
| PubChem CID | 54720435 |
| Molecular Formula | C21H34O12 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [(1S)-1-hydroxy-1-[3-hydroxy-5-oxo-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-2-yl]propan-2-yl] 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OC(C)[C@H](O)C1OC(=O)C(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)=C1O |
| InChI | InChI=1S/C21H34O12/c1-4-6-10(7-5-2)19(28)30-9(3)12(23)17-16(27)18(20(29)32-17)33-21-15(26)14(25)13(24)11(8-22)31-21/h9-15,17,21-27H,4-8H2,1-3H3/t9?,11-,12+,13-,14+,15-,17?,21?/m1/s1 |
| InChIKey | RSVZZTSJNFSNFL-GTLTUYTOSA-N |
| XLogP | -0.99 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |