C16H26O11 — CID 46898601
(2R)-3-butoxy-2-[(1R)-1,2-dihydroxyethyl]-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one (PubChem CID 46898601) has the molecular formula C16H26O11 and a molecular weight of 394.37 g/mol. Its IUPAC name is (2R)-3-butoxy-2-[(1R)-1,2-dihydroxyethyl]-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one.
| Compound Name | (2R)-3-butoxy-2-[(1R)-1,2-dihydroxyethyl]-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
|---|---|
| PubChem CID | 46898601 |
| Molecular Formula | C16H26O11 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (2R)-3-butoxy-2-[(1R)-1,2-dihydroxyethyl]-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
| SMILES | CCCCOC1=C(O[C@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)C(=O)O[C@@H]1[C@H](O)CO |
| InChI | InChI=1S/C16H26O11/c1-2-3-4-24-13-12(7(19)5-17)26-15(23)14(13)27-16-11(22)10(21)9(20)8(6-18)25-16/h7-12,16-22H,2-6H2,1H3/t7-,8+,9+,10-,11+,12-,16-/m1/s1 |
| InChIKey | ZHALPNUZZVMAPQ-RHEVVPDKSA-N |
| XLogP | -2.89 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|