C28H25N3O3S — CID 5472066
(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenyl-3-(5-propylsulfanyl-1H-indol-2-yl)imidazol-4-one (PubChem CID 5472066) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenyl-3-(5-propylsulfanyl-1H-indol-2-yl)imidazol-4-one.
| Compound Name | (5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenyl-3-(5-propylsulfanyl-1H-indol-2-yl)imidazol-4-one |
|---|---|
| PubChem CID | 5472066 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-phenyl-3-(5-propylsulfanyl-1H-indol-2-yl)imidazol-4-one |
| SMILES | CCCSc1ccc2[nH]c(N3C(=O)/C(=C/c4ccc(O)c(OC)c4)N=C3c3ccccc3)cc2c1 |
| InChI | InChI=1S/C28H25N3O3S/c1-3-13-35-21-10-11-22-20(16-21)17-26(29-22)31-27(19-7-5-4-6-8-19)30-23(28(31)33)14-18-9-12-24(32)25(15-18)34-2/h4-12,14-17,29,32H,3,13H2,1-2H3/b23-14- |
| InChIKey | RSKSGANXKWNKJD-UCQKPKSFSA-N |
| XLogP | 6.22 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|