C15H18NO5S+ — CID 54723329
2-acetamidoethyl-(4-hydroxy-7-methoxy-2-oxochromen-3-yl)-methylsulfanium (PubChem CID 54723329) has the molecular formula C15H18NO5S+ and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-acetamidoethyl-(4-hydroxy-7-methoxy-2-oxochromen-3-yl)-methylsulfanium.
| Compound Name | 2-acetamidoethyl-(4-hydroxy-7-methoxy-2-oxochromen-3-yl)-methylsulfanium |
|---|---|
| PubChem CID | 54723329 |
| Molecular Formula | C15H18NO5S+ |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-acetamidoethyl-(4-hydroxy-7-methoxy-2-oxochromen-3-yl)-methylsulfanium |
| SMILES | COc1ccc2c(O)c([S+](C)CCNC(C)=O)c(=O)oc2c1 |
| InChI | InChI=1S/C15H17NO5S/c1-9(17)16-6-7-22(3)14-13(18)11-5-4-10(20-2)8-12(11)21-15(14)19/h4-5,8H,6-7H2,1-3H3,(H-,16,17,18,19)/p+1 |
| InChIKey | VRQYLXLSQLXCCA-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|