C23H25ClNO7S+ — CID 54721086
(7-chloro-4-hydroxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium (PubChem CID 54721086) has the molecular formula C23H25ClNO7S+ and a molecular weight of 494.97 g/mol. Its IUPAC name is (7-chloro-4-hydroxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium.
| Compound Name | (7-chloro-4-hydroxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium |
|---|---|
| PubChem CID | 54721086 |
| Molecular Formula | C23H25ClNO7S+ |
| Molecular Weight | 494.97 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (7-chloro-4-hydroxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium |
| SMILES | COc1cc(C(=O)N(C)CC[S+](C)c2c(O)c3ccc(Cl)cc3oc2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H24ClNO7S/c1-25(22(27)13-10-17(29-2)20(31-4)18(11-13)30-3)8-9-33(5)21-19(26)15-7-6-14(24)12-16(15)32-23(21)28/h6-7,10-12H,8-9H2,1-5H3/p+1 |
| InChIKey | JVWNAEFLGBBYKL-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.97 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|