C24H28NO8S+ — CID 54712221
(4-hydroxy-6-methoxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium (PubChem CID 54712221) has the molecular formula C24H28NO8S+ and a molecular weight of 490.55 g/mol. Its IUPAC name is (4-hydroxy-6-methoxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium.
| Compound Name | (4-hydroxy-6-methoxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium |
|---|---|
| PubChem CID | 54712221 |
| Molecular Formula | C24H28NO8S+ |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (4-hydroxy-6-methoxy-2-oxochromen-3-yl)-methyl-[2-[methyl-(3,4,5-trimethoxybenzoyl)amino]ethyl]sulfanium |
| SMILES | COc1ccc2oc(=O)c([S+](C)CCN(C)C(=O)c3cc(OC)c(OC)c(OC)c3)c(O)c2c1 |
| InChI | InChI=1S/C24H27NO8S/c1-25(23(27)14-11-18(30-3)21(32-5)19(12-14)31-4)9-10-34(6)22-20(26)16-13-15(29-2)7-8-17(16)33-24(22)28/h7-8,11-13H,9-10H2,1-6H3/p+1 |
| InChIKey | UMXCUDCKYIKJJF-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|