C10H5ClO5 — CID 54728310
4,5-dihydroxy-2-oxochromene-3-carbonyl chloride (PubChem CID 54728310) has the molecular formula C10H5ClO5 and a molecular weight of 240.60 g/mol. Its IUPAC name is 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride.
| Compound Name | 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride |
|---|---|
| PubChem CID | 54728310 |
| Molecular Formula | C10H5ClO5 |
| Molecular Weight | 240.60 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride |
| SMILES | O=C(Cl)c1c(O)c2c(O)cccc2oc1=O |
| InChI | InChI=1S/C10H5ClO5/c11-9(14)7-8(13)6-4(12)2-1-3-5(6)16-10(7)15/h1-3,12-13H |
| InChIKey | ASVYJJZAIKCESH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.60 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|