4,5-dihydroxy-2-oxochromene-3-carbonyl chloride

C10H5ClO5 — CID 54728310

IUPAC4,5-dihydroxy-2-oxochromene-3-carbonyl chloride
SMILESO=C(Cl)c1c(O)c2c(O)cccc2oc1=O
InChIInChI=1S/C10H5ClO5/c11-9(14)7-8(13)6-4(12)2-1-3-5(6)16-10(7)15/h1-3,12-13H
InChIKeyASVYJJZAIKCESH-UHFFFAOYSA-N
MW240.60 g/mol
LogP1.58
Rot. Bonds1

About 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride

4,5-dihydroxy-2-oxochromene-3-carbonyl chloride (PubChem CID 54728310) has the molecular formula C10H5ClO5 and a molecular weight of 240.60 g/mol. Its IUPAC name is 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride.

Molecular Properties

Compound Name4,5-dihydroxy-2-oxochromene-3-carbonyl chloride
PubChem CID54728310
Molecular FormulaC10H5ClO5
Molecular Weight240.60 g/mol
Exact Mass239.98
IUPAC Name4,5-dihydroxy-2-oxochromene-3-carbonyl chloride
SMILESO=C(Cl)c1c(O)c2c(O)cccc2oc1=O
InChIInChI=1S/C10H5ClO5/c11-9(14)7-8(13)6-4(12)2-1-3-5(6)16-10(7)15/h1-3,12-13H
InChIKeyASVYJJZAIKCESH-UHFFFAOYSA-N
XLogP1.58
TPSA87.74 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.60
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride?
The IUPAC name of 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride (CID 54728310) is 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride.
What is the SMILES notation for 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride?
The canonical SMILES for 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride is O=C(Cl)c1c(O)c2c(O)cccc2oc1=O.
What is the InChIKey of 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride?
The InChIKey is ASVYJJZAIKCESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClO5/c11-9(14)7-8(13)6-4(12)2-1-3-5(6)16-10(7)15/h1-3,12-13H.
What are the key properties of 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride?
4,5-dihydroxy-2-oxochromene-3-carbonyl chloride has a molecular weight of 240.60 g/mol, XLogP of 1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-2-oxochromene-3-carbonyl chloride is sourced from PubChem (CID 54728310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).