C24H28O5 — CID 54729589
6-[6-(3-cyclohexylpropoxy)-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one (PubChem CID 54729589) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 6-[6-(3-cyclohexylpropoxy)-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one.
| Compound Name | 6-[6-(3-cyclohexylpropoxy)-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one |
|---|---|
| PubChem CID | 54729589 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 6-[6-(3-cyclohexylpropoxy)-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one |
| SMILES | Cc1c(-c2cc3ccc(OCCCC4CCCCC4)cc3o2)oc(=O)c(C)c1O |
| InChI | InChI=1S/C24H28O5/c1-15-22(25)16(2)24(26)29-23(15)21-13-18-10-11-19(14-20(18)28-21)27-12-6-9-17-7-4-3-5-8-17/h10-11,13-14,17,25H,3-9,12H2,1-2H3 |
| InChIKey | DUGISVZJKQREIN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|