C22H19NO5 — CID 54728228
6-[5-[(3-aminophenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one (PubChem CID 54728228) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 6-[5-[(3-aminophenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one.
| Compound Name | 6-[5-[(3-aminophenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one |
|---|---|
| PubChem CID | 54728228 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 6-[5-[(3-aminophenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one |
| SMILES | Cc1c(-c2cc3cc(OCc4cccc(N)c4)ccc3o2)oc(=O)c(C)c1O |
| InChI | InChI=1S/C22H19NO5/c1-12-20(24)13(2)22(25)28-21(12)19-10-15-9-17(6-7-18(15)27-19)26-11-14-4-3-5-16(23)8-14/h3-10,24H,11,23H2,1-2H3 |
| InChIKey | NEJFBSHUDIAIER-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|