C14H29NO7P2 — CID 5473005
2-[[(3E)-4,8-dimethylnona-3,7-dienyl]-methylamino]ethyl phosphono hydrogen phosphate (PubChem CID 5473005) has the molecular formula C14H29NO7P2 and a molecular weight of 385.33 g/mol. Its IUPAC name is 2-[[(3E)-4,8-dimethylnona-3,7-dienyl]-methylamino]ethyl phosphono hydrogen phosphate.
| Compound Name | 2-[[(3E)-4,8-dimethylnona-3,7-dienyl]-methylamino]ethyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 5473005 |
| Molecular Formula | C14H29NO7P2 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[[(3E)-4,8-dimethylnona-3,7-dienyl]-methylamino]ethyl phosphono hydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/CCN(C)CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C14H29NO7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9H,5-6,8,10-12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+ |
| InChIKey | UJQJOPPVQKRHHI-NTEUORMPSA-N |
| XLogP | 3.23 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|