C31H37N3O3 — CID 54730188
4-hydroxy-2-oxo-N-[3-(5-phenyl-2-azatricyclo[3.3.1.13,7]decan-2-yl)propyl]-1-propan-2-ylquinoline-3-carboxamide (PubChem CID 54730188) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-N-[3-(5-phenyl-2-azatricyclo[3.3.1.13,7]decan-2-yl)propyl]-1-propan-2-ylquinoline-3-carboxamide.
| Compound Name | 4-hydroxy-2-oxo-N-[3-(5-phenyl-2-azatricyclo[3.3.1.13,7]decan-2-yl)propyl]-1-propan-2-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54730188 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 4-hydroxy-2-oxo-N-[3-(5-phenyl-2-azatricyclo[3.3.1.13,7]decan-2-yl)propyl]-1-propan-2-ylquinoline-3-carboxamide |
| SMILES | CC(C)n1c(=O)c(C(=O)NCCCN2C3CC4CC2CC(c2ccccc2)(C4)C3)c(O)c2ccccc21 |
| InChI | InChI=1S/C31H37N3O3/c1-20(2)34-26-12-7-6-11-25(26)28(35)27(30(34)37)29(36)32-13-8-14-33-23-15-21-16-24(33)19-31(17-21,18-23)22-9-4-3-5-10-22/h3-7,9-12,20-21,23-24,35H,8,13-19H2,1-2H3,(H,32,36) |
| InChIKey | XVWWSGUSPNQWMS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|