C24H35N3O7S — CID 160756968
(Z)-but-2-enedioic acid;4-hydroxy-6-oxo-N-(3-piperidin-1-ylpropyl)-7-propan-2-ylthieno[2,3-b]pyridine-5-carboxamide;methane (PubChem CID 160756968) has the molecular formula C24H35N3O7S and a molecular weight of 509.63 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-hydroxy-6-oxo-N-(3-piperidin-1-ylpropyl)-7-propan-2-ylthieno[2,3-b]pyridine-5-carboxamide;methane.
| Compound Name | (Z)-but-2-enedioic acid;4-hydroxy-6-oxo-N-(3-piperidin-1-ylpropyl)-7-propan-2-ylthieno[2,3-b]pyridine-5-carboxamide;methane |
|---|---|
| PubChem CID | 160756968 |
| Molecular Formula | C24H35N3O7S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-hydroxy-6-oxo-N-(3-piperidin-1-ylpropyl)-7-propan-2-ylthieno[2,3-b]pyridine-5-carboxamide;methane |
| SMILES | C.CC(C)n1c(=O)c(C(=O)NCCCN2CCCCC2)c(O)c2ccsc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H27N3O3S.C4H4O4.CH4/c1-13(2)22-18(25)15(16(23)14-7-12-26-19(14)22)17(24)20-8-6-11-21-9-4-3-5-10-21;5-3(6)1-2-4(7)8;/h7,12-13,23H,3-6,8-11H2,1-2H3,(H,20,24);1-2H,(H,5,6)(H,7,8);1H4/b;2-1-; |
| InChIKey | ZPWKHLUCQQHTQE-FJOGWHKWSA-N |
| XLogP | 3.30 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|