C19H26N3NaO3S — CID 58119829
sodium 5-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propylcarbamoyl]-6-oxo-7-(1,1,1-trideuteriopropan-2-yl)thieno[2,3-b]pyridin-4-olate (PubChem CID 58119829) has the molecular formula C19H26N3NaO3S and a molecular weight of 412.57 g/mol. Its IUPAC name is sodium 5-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propylcarbamoyl]-6-oxo-7-(1,1,1-trideuteriopropan-2-yl)thieno[2,3-b]pyridin-4-olate.
| Compound Name | sodium 5-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propylcarbamoyl]-6-oxo-7-(1,1,1-trideuteriopropan-2-yl)thieno[2,3-b]pyridin-4-olate |
|---|---|
| PubChem CID | 58119829 |
| Molecular Formula | C19H26N3NaO3S |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | sodium 5-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)propylcarbamoyl]-6-oxo-7-(1,1,1-trideuteriopropan-2-yl)thieno[2,3-b]pyridin-4-olate |
| SMILES | [2H]C([2H])([2H])C(C)n1c(=O)c(C(=O)NCCCN2C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C2([2H])[2H])c([O-])c2ccsc21.[Na+] |
| InChI | InChI=1S/C19H27N3O3S.Na/c1-13(2)22-18(25)15(16(23)14-7-12-26-19(14)22)17(24)20-8-6-11-21-9-4-3-5-10-21;/h7,12-13,23H,3-6,8-11H2,1-2H3,(H,20,24);/q;+1/p-1/i1D3,3D2,4D2,5D2,9D2,10D2; |
| InChIKey | KHQCXBWWZZFUED-OUEMKCEYSA-M |
| XLogP | -0.67 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|