C19H27KN3O3S — CID 66863218
VRX 03011 Potassium salt (PubChem CID 66863218) has the molecular formula C19H27KN3O3S and a molecular weight of 416.61 g/mol.
| Compound Name | VRX 03011 Potassium salt |
|---|---|
| PubChem CID | 66863218 |
| Molecular Formula | C19H27KN3O3S |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | — |
| SMILES | CC(C)n1c(=O)c(C(=O)NCCCN2CCCCC2)c(O)c2ccsc21.[K] |
| InChI | InChI=1S/C19H27N3O3S.K/c1-13(2)22-18(25)15(16(23)14-7-12-26-19(14)22)17(24)20-8-6-11-21-9-4-3-5-10-21;/h7,12-13,23H,3-6,8-11H2,1-2H3,(H,20,24); |
| InChIKey | UOXGVDKWPKQJGZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|