C27H27NO3S — CID 54731628
ethyl (2S,3S,6S)-4-hydroxy-3-(4-methylphenyl)sulfanyl-2,6-diphenyl-1,2,3,6-tetrahydropyridine-5-carboxylate (PubChem CID 54731628) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is ethyl (2S,3S,6S)-4-hydroxy-3-(4-methylphenyl)sulfanyl-2,6-diphenyl-1,2,3,6-tetrahydropyridine-5-carboxylate.
| Compound Name | ethyl (2S,3S,6S)-4-hydroxy-3-(4-methylphenyl)sulfanyl-2,6-diphenyl-1,2,3,6-tetrahydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 54731628 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | ethyl (2S,3S,6S)-4-hydroxy-3-(4-methylphenyl)sulfanyl-2,6-diphenyl-1,2,3,6-tetrahydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(O)[C@@H](Sc2ccc(C)cc2)[C@H](c2ccccc2)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H27NO3S/c1-3-31-27(30)22-23(19-10-6-4-7-11-19)28-24(20-12-8-5-9-13-20)26(25(22)29)32-21-16-14-18(2)15-17-21/h4-17,23-24,26,28-29H,3H2,1-2H3/t23-,24-,26-/m0/s1 |
| InChIKey | NQJFANZUERZWIT-GNKBHMEESA-N |
| XLogP | 5.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |