C20H17NO3 — CID 54731809
(3Z)-3-[(2E,4E)-1-hydroxy-4-methyl-5-naphthalen-2-ylpenta-2,4-dienylidene]pyrrolidine-2,4-dione (PubChem CID 54731809) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is (3Z)-3-[(2E,4E)-1-hydroxy-4-methyl-5-naphthalen-2-ylpenta-2,4-dienylidene]pyrrolidine-2,4-dione.
| Compound Name | (3Z)-3-[(2E,4E)-1-hydroxy-4-methyl-5-naphthalen-2-ylpenta-2,4-dienylidene]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 54731809 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (3Z)-3-[(2E,4E)-1-hydroxy-4-methyl-5-naphthalen-2-ylpenta-2,4-dienylidene]pyrrolidine-2,4-dione |
| SMILES | CC(/C=C/C(O)=C1\C(=O)CNC1=O)=C\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17NO3/c1-13(6-9-17(22)19-18(23)12-21-20(19)24)10-14-7-8-15-4-2-3-5-16(15)11-14/h2-11,22H,12H2,1H3,(H,21,24)/b9-6+,13-10+,19-17- |
| InChIKey | MSHDBHUBIQZNJB-YABWGTBVSA-N |
| XLogP | 3.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|