C22H33AlN2O7+6 — CID 54733033
aluminum;[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]-[2-[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]azaniumylphenyl]azanium;ethyloxidanium (PubChem CID 54733033) has the molecular formula C22H33AlN2O7+6 and a molecular weight of 464.50 g/mol. Its IUPAC name is aluminum;[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]-[2-[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]azaniumylphenyl]azanium;ethyloxidanium.
| Compound Name | aluminum;[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]-[2-[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]azaniumylphenyl]azanium;ethyloxidanium |
|---|---|
| PubChem CID | 54733033 |
| Molecular Formula | C22H33AlN2O7+6 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | aluminum;[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]-[2-[(E)-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]azaniumylphenyl]azanium;ethyloxidanium |
| SMILES | CCOC(=O)C(/C=[NH+]/c1ccccc1/[NH+]=C/C(C(=O)OCC)=C(/C)O)=C(\C)O.CC[OH2+].[Al+3] |
| InChI | InChI=1S/C20H24N2O6.C2H6O.Al/c1-5-27-19(25)15(13(3)23)11-21-17-9-7-8-10-18(17)22-12-16(14(4)24)20(26)28-6-2;1-2-3;/h7-12,23-24H,5-6H2,1-4H3;3H,2H2,1H3;/q;;+3/p+3/b15-13+,16-14+,21-11+,22-12+;; |
| InChIKey | AVOLPYRJBGICIY-ZTTJKFNSSA-Q |
| XLogP | -0.61 |
| TPSA | 143.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|