C32H38N4O7 — CID 54734137
(4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-7-(propylamino)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54734137) has the molecular formula C32H38N4O7 and a molecular weight of 590.68 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-7-(propylamino)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-7-(propylamino)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54734137 |
| Molecular Formula | C32H38N4O7 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | (4S,4aS,5aR,14aR)-10-(azetidin-1-ylmethyl)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-7-(propylamino)-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CCCNc1c2c(c(O)c3cc(CN4CCC4)ccc13)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C32H38N4O7/c1-4-8-34-24-17-7-6-15(14-36-9-5-10-36)11-18(17)26(37)22-19(24)12-16-13-20-25(35(2)3)28(39)23(31(33)42)30(41)32(20,43)29(40)21(16)27(22)38/h6-7,11,16,20,25,34,37-38,41,43H,4-5,8-10,12-14H2,1-3H3,(H2,33,42)/t16-,20-,25-,32-/m0/s1 |
| InChIKey | KZFWLKUPXAWAFR-XCZMHNGLSA-N |
| XLogP | 2.14 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|