C22H18BrNO6 — CID 54742419
(Z)-3-[4-bromo-3-(4-methoxyphenyl)isoquinolin-2-ium-2-yl]-1,4-dimethoxy-1,4-dioxobut-2-en-2-olate (PubChem CID 54742419) has the molecular formula C22H18BrNO6 and a molecular weight of 472.29 g/mol. Its IUPAC name is (Z)-3-[4-bromo-3-(4-methoxyphenyl)isoquinolin-2-ium-2-yl]-1,4-dimethoxy-1,4-dioxobut-2-en-2-olate.
| Compound Name | (Z)-3-[4-bromo-3-(4-methoxyphenyl)isoquinolin-2-ium-2-yl]-1,4-dimethoxy-1,4-dioxobut-2-en-2-olate |
|---|---|
| PubChem CID | 54742419 |
| Molecular Formula | C22H18BrNO6 |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | (Z)-3-[4-bromo-3-(4-methoxyphenyl)isoquinolin-2-ium-2-yl]-1,4-dimethoxy-1,4-dioxobut-2-en-2-olate |
| SMILES | COC(=O)/C([O-])=C(\C(=O)OC)[n+]1cc2ccccc2c(Br)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H18BrNO6/c1-28-15-10-8-13(9-11-15)18-17(23)16-7-5-4-6-14(16)12-24(18)19(21(26)29-2)20(25)22(27)30-3/h4-12H,1-3H3 |
| InChIKey | VPUKVIBFOAOTFQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|