C28H33FN4O8 — CID 54742791
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,6-tetrahydrotetracene-2-carboxamide (PubChem CID 54742791) has the molecular formula C28H33FN4O8 and a molecular weight of 572.59 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54742791 |
| Molecular Formula | C28H33FN4O8 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)CN5CCCC5)cc(F)c4C[C@@]3(C)C[C@@H]12 |
| InChI | InChI=1S/C28H33FN4O8/c1-27-9-12-14(29)8-15(31-16(34)11-33-6-4-5-7-33)21(35)17(12)22(36)19(27)25(39)28(41)13(10-27)20(32(2)3)23(37)18(24(28)38)26(30)40/h8,13,20,35-36,38,41H,4-7,9-11H2,1-3H3,(H2,30,40)(H,31,34)/t13-,20-,27-,28+/m0/s1 |
| InChIKey | NKOJEHCXEAMBKS-LOWRRQGLSA-N |
| XLogP | 0.53 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|