C16H19NO4 — CID 54748241
2-hydroxy-N-(3-methoxyphenyl)-4,4-dimethyl-6-oxocyclohexene-1-carboxamide (PubChem CID 54748241) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-hydroxy-N-(3-methoxyphenyl)-4,4-dimethyl-6-oxocyclohexene-1-carboxamide.
| Compound Name | 2-hydroxy-N-(3-methoxyphenyl)-4,4-dimethyl-6-oxocyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 54748241 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-hydroxy-N-(3-methoxyphenyl)-4,4-dimethyl-6-oxocyclohexene-1-carboxamide |
| SMILES | COc1cccc(NC(=O)C2=C(O)CC(C)(C)CC2=O)c1 |
| InChI | InChI=1S/C16H19NO4/c1-16(2)8-12(18)14(13(19)9-16)15(20)17-10-5-4-6-11(7-10)21-3/h4-7,18H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | HJUMCXZHELWBCW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|