C13H10FNO3S — CID 54748747
N-[(4-fluorophenyl)methyl]-3-hydroxy-4-sulfanylidenepyran-2-carboxamide (PubChem CID 54748747) has the molecular formula C13H10FNO3S and a molecular weight of 279.29 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-4-sulfanylidenepyran-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-4-sulfanylidenepyran-2-carboxamide |
|---|---|
| PubChem CID | 54748747 |
| Molecular Formula | C13H10FNO3S |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-4-sulfanylidenepyran-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1occc(=S)c1O |
| InChI | InChI=1S/C13H10FNO3S/c14-9-3-1-8(2-4-9)7-15-13(17)12-11(16)10(19)5-6-18-12/h1-6,16H,7H2,(H,15,17) |
| InChIKey | ZCHYUDFWOCSZIM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|